Category: | Alkaloids | |
---|---|---|
Appearance: | powder | |
Purity: | 95~98%(HPLC) | |
Storage conditions: | -20°C under seal save, placed in ventilated, dry environment | |
Application: | All our products are for research and lab only. Injecting, eating and other ways are forbidden. | |
Package: | 5mg,10mg ,20mg ,50mg ,100mg,1g, 100g or customized | |
SMILES: | C1OC2=CC3C4CC5=C(CN4CCC=3C=C2O1)C1OCOC=1C=C5 |
TBW04327 | Tetrahydroharmine | CAS No.17019-01-1 | C13H16N2O |
TBW04177 | Oleracein E | CAS No.1021950-79-7 | C12H13NO3 |
T015294 | Demethyleneberberine | CAS No.25459-91-0 | C19H18NO4 |
TA001009 | Acetylaconitine | CAS No.77181-26-1 | C36H49NO12 |
TA014096 | Sipeimine | CAS No.61825-98-7 | C27H43NO3 |
TA056301 | Sophoridine | CAS No.83148-91-8 | C15H24N2O |
TB00001 | Gelsemine | CAS No.509-15-9 | C20H22N2O2 |
TB00002 | Koumine | CAS No.1358-76-5 | C20H22N2O |
TB00003 | Humantenmine | CAS No.82354-38-9 | C19H22N2O3 |
TB00004 | Ajmalicine | CAS No.483-04-5 | C21H24N2O3 |
TB00005 | Vasicinolone | CAS No.84847-50-7 | C11H10N2O3 |
TB00011 | Humantenine | CAS No.82375-29-9 | C21H26N2O3 |
TB00012 | (Z)-Akuammidine | CAS No.113973-31-2 | C21H24N2O3 |
TB00018 | Vasicine | CAS No.6159-55-3 | C11H12N2O |
TB00058 | Indole-3-carboxylic acid | CAS No.771-50-6 | C9H7NO2 |
TB00067 | Vasicinol | CAS No.5081-51-6 | C11H12N2O2 |
TB00088 | Vasicinone | CAS No.486-64-6 | C11H10N2O2 |
TB00096 | Harmine | CAS No.442-51-3 | C13H12N2O |
TB001005 | Benzoylmesaconine | CAS No.63238-67-5 | C31H43NO10 |
TB001007 | Benzoylhypacoitine | CAS No.63238-66-4 | C31H43NO9 |